C11H13NO4S — CID 71712627
(3S,4R,5S)-5-(4-methoxyphenyl)-4-nitrothiolan-3-ol (PubChem CID 71712627) has the molecular formula C11H13NO4S and a molecular weight of 255.30 g/mol. Its IUPAC name is (3S,4R,5S)-5-(4-methoxyphenyl)-4-nitrothiolan-3-ol.
| Compound Name | (3S,4R,5S)-5-(4-methoxyphenyl)-4-nitrothiolan-3-ol |
|---|---|
| PubChem CID | 71712627 |
| Molecular Formula | C11H13NO4S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | (3S,4R,5S)-5-(4-methoxyphenyl)-4-nitrothiolan-3-ol |
| SMILES | COc1ccc([C@@H]2SC[C@@H](O)[C@H]2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H13NO4S/c1-16-8-4-2-7(3-5-8)11-10(12(14)15)9(13)6-17-11/h2-5,9-11,13H,6H2,1H3/t9-,10-,11+/m1/s1 |
| InChIKey | UBWVOIFBRTUPOU-MXWKQRLJSA-N |
| XLogP | 1.49 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|