C16H15NO3S — CID 101428482
(2R,3S,3aR)-2-(4-methoxyphenyl)-3-nitro-3,3a-dihydro-2H-cyclohepta[b]thiophene (PubChem CID 101428482) has the molecular formula C16H15NO3S and a molecular weight of 301.37 g/mol. Its IUPAC name is (2R,3S,3aR)-2-(4-methoxyphenyl)-3-nitro-3,3a-dihydro-2H-cyclohepta[b]thiophene.
| Compound Name | (2R,3S,3aR)-2-(4-methoxyphenyl)-3-nitro-3,3a-dihydro-2H-cyclohepta[b]thiophene |
|---|---|
| PubChem CID | 101428482 |
| Molecular Formula | C16H15NO3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | (2R,3S,3aR)-2-(4-methoxyphenyl)-3-nitro-3,3a-dihydro-2H-cyclohepta[b]thiophene |
| SMILES | COc1ccc([C@H]2SC3=CC=CC=C[C@@H]3[C@@H]2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H15NO3S/c1-20-12-9-7-11(8-10-12)16-15(17(18)19)13-5-3-2-4-6-14(13)21-16/h2-10,13,15-16H,1H3/t13-,15-,16+/m0/s1 |
| InChIKey | OIMJXLHYPPHZMI-CWRNSKLLSA-N |
| XLogP | 3.75 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|