C15H20N2O6 — CID 101456272
(1R,2S,3R,4R,5R)-5-ethyl-3-(4-methoxyphenyl)-2,4-dinitrocyclohexan-1-ol (PubChem CID 101456272) has the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. Its IUPAC name is (1R,2S,3R,4R,5R)-5-ethyl-3-(4-methoxyphenyl)-2,4-dinitrocyclohexan-1-ol.
| Compound Name | (1R,2S,3R,4R,5R)-5-ethyl-3-(4-methoxyphenyl)-2,4-dinitrocyclohexan-1-ol |
|---|---|
| PubChem CID | 101456272 |
| Molecular Formula | C15H20N2O6 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | (1R,2S,3R,4R,5R)-5-ethyl-3-(4-methoxyphenyl)-2,4-dinitrocyclohexan-1-ol |
| SMILES | CC[C@@H]1C[C@@H](O)[C@@H]([N+](=O)[O-])[C@H](c2ccc(OC)cc2)[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C15H20N2O6/c1-3-9-8-12(18)15(17(21)22)13(14(9)16(19)20)10-4-6-11(23-2)7-5-10/h4-7,9,12-15,18H,3,8H2,1-2H3/t9-,12-,13-,14-,15-/m1/s1 |
| InChIKey | JGXZIPMYMKWDNC-WMESBKTJSA-N |
| XLogP | 1.86 |
| TPSA | 115.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|