C21H23ClN2O3 — CID 102444773
4-(4-chlorophenyl)-2-ethyl-1-(4-methoxyphenyl)-5-methyl-3-nitro-3,4-dihydro-2H-pyridine (PubChem CID 102444773) has the molecular formula C21H23ClN2O3 and a molecular weight of 386.88 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-ethyl-1-(4-methoxyphenyl)-5-methyl-3-nitro-3,4-dihydro-2H-pyridine.
| Compound Name | 4-(4-chlorophenyl)-2-ethyl-1-(4-methoxyphenyl)-5-methyl-3-nitro-3,4-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 102444773 |
| Molecular Formula | C21H23ClN2O3 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 4-(4-chlorophenyl)-2-ethyl-1-(4-methoxyphenyl)-5-methyl-3-nitro-3,4-dihydro-2H-pyridine |
| SMILES | CCC1C([N+](=O)[O-])C(c2ccc(Cl)cc2)C(C)=CN1c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H23ClN2O3/c1-4-19-21(24(25)26)20(15-5-7-16(22)8-6-15)14(2)13-23(19)17-9-11-18(27-3)12-10-17/h5-13,19-21H,4H2,1-3H3 |
| InChIKey | DMAMXRJSKGLZOE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|