C22H23NO5 — CID 166439920
ethyl (4S,5S,6S)-4-(4-methoxyphenyl)-5-nitro-6-phenylcyclohexene-1-carboxylate (PubChem CID 166439920) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is ethyl (4S,5S,6S)-4-(4-methoxyphenyl)-5-nitro-6-phenylcyclohexene-1-carboxylate.
| Compound Name | ethyl (4S,5S,6S)-4-(4-methoxyphenyl)-5-nitro-6-phenylcyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 166439920 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | ethyl (4S,5S,6S)-4-(4-methoxyphenyl)-5-nitro-6-phenylcyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=CC[C@@H](c2ccc(OC)cc2)[C@H]([N+](=O)[O-])[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H23NO5/c1-3-28-22(24)19-14-13-18(15-9-11-17(27-2)12-10-15)21(23(25)26)20(19)16-7-5-4-6-8-16/h4-12,14,18,20-21H,3,13H2,1-2H3/t18-,20-,21-/m0/s1 |
| InChIKey | AMVIXFLHPNVEQE-JBACZVJFSA-N |
| XLogP | 4.10 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|