C15H17NO6 — CID 53259142
ethyl (2R,3R)-3-(4-methoxyphenyl)-5-methyl-2-nitro-2,3-dihydrofuran-4-carboxylate (PubChem CID 53259142) has the molecular formula C15H17NO6 and a molecular weight of 307.30 g/mol. Its IUPAC name is ethyl (2R,3R)-3-(4-methoxyphenyl)-5-methyl-2-nitro-2,3-dihydrofuran-4-carboxylate.
| Compound Name | ethyl (2R,3R)-3-(4-methoxyphenyl)-5-methyl-2-nitro-2,3-dihydrofuran-4-carboxylate |
|---|---|
| PubChem CID | 53259142 |
| Molecular Formula | C15H17NO6 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | ethyl (2R,3R)-3-(4-methoxyphenyl)-5-methyl-2-nitro-2,3-dihydrofuran-4-carboxylate |
| SMILES | CCOC(=O)C1=C(C)O[C@@H]([N+](=O)[O-])[C@@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C15H17NO6/c1-4-21-15(17)12-9(2)22-14(16(18)19)13(12)10-5-7-11(20-3)8-6-10/h5-8,13-14H,4H2,1-3H3/t13-,14-/m1/s1 |
| InChIKey | HEXAYAUDDPXKOW-ZIAGYGMSSA-N |
| XLogP | 2.25 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|