C33H48N2O3 — CID 102444776
5-heptyl-1-(4-methoxyphenyl)-3-nitro-2-octyl-4-phenyl-3,4-dihydro-2H-pyridine (PubChem CID 102444776) has the molecular formula C33H48N2O3 and a molecular weight of 520.76 g/mol. Its IUPAC name is 5-heptyl-1-(4-methoxyphenyl)-3-nitro-2-octyl-4-phenyl-3,4-dihydro-2H-pyridine.
| Compound Name | 5-heptyl-1-(4-methoxyphenyl)-3-nitro-2-octyl-4-phenyl-3,4-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 102444776 |
| Molecular Formula | C33H48N2O3 |
| Molecular Weight | 520.76 g/mol |
| Exact Mass | 520.37 |
| IUPAC Name | 5-heptyl-1-(4-methoxyphenyl)-3-nitro-2-octyl-4-phenyl-3,4-dihydro-2H-pyridine |
| SMILES | CCCCCCCCC1C([N+](=O)[O-])C(c2ccccc2)C(CCCCCCC)=CN1c1ccc(OC)cc1 |
| InChI | InChI=1S/C33H48N2O3/c1-4-6-8-10-12-17-21-31-33(35(36)37)32(27-18-15-13-16-19-27)28(20-14-11-9-7-5-2)26-34(31)29-22-24-30(38-3)25-23-29/h13,15-16,18-19,22-26,31-33H,4-12,14,17,20-21H2,1-3H3 |
| InChIKey | WUGSIDPYMKCIHQ-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.76 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|