C22H24N2O4 — CID 154598200
(3S,4S,5R)-3-(cyclopropylmethyl)-1-[(4-methoxyphenyl)methyl]-4-nitro-5-phenylpyrrolidin-2-one (PubChem CID 154598200) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is (3S,4S,5R)-3-(cyclopropylmethyl)-1-[(4-methoxyphenyl)methyl]-4-nitro-5-phenylpyrrolidin-2-one.
| Compound Name | (3S,4S,5R)-3-(cyclopropylmethyl)-1-[(4-methoxyphenyl)methyl]-4-nitro-5-phenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 154598200 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | (3S,4S,5R)-3-(cyclopropylmethyl)-1-[(4-methoxyphenyl)methyl]-4-nitro-5-phenylpyrrolidin-2-one |
| SMILES | COc1ccc(CN2C(=O)[C@@H](CC3CC3)[C@H]([N+](=O)[O-])[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C22H24N2O4/c1-28-18-11-9-16(10-12-18)14-23-20(17-5-3-2-4-6-17)21(24(26)27)19(22(23)25)13-15-7-8-15/h2-6,9-12,15,19-21H,7-8,13-14H2,1H3/t19-,20+,21-/m0/s1 |
| InChIKey | VOIHAWVDWRTUTA-HBMCJLEFSA-N |
| XLogP | 3.84 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|