C19H30N2O2 — CID 102356633
(2R,3S)-2-heptyl-3-nitro-1-(1-phenylethyl)pyrrolidine (PubChem CID 102356633) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is (2R,3S)-2-heptyl-3-nitro-1-(1-phenylethyl)pyrrolidine.
| Compound Name | (2R,3S)-2-heptyl-3-nitro-1-(1-phenylethyl)pyrrolidine |
|---|---|
| PubChem CID | 102356633 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | (2R,3S)-2-heptyl-3-nitro-1-(1-phenylethyl)pyrrolidine |
| SMILES | CCCCCCC[C@@H]1[C@@H]([N+](=O)[O-])CCN1C(C)c1ccccc1 |
| InChI | InChI=1S/C19H30N2O2/c1-3-4-5-6-10-13-18-19(21(22)23)14-15-20(18)16(2)17-11-8-7-9-12-17/h7-9,11-12,16,18-19H,3-6,10,13-15H2,1-2H3/t16?,18-,19+/m1/s1 |
| InChIKey | GERLUIJTWDIFLZ-VITQDTLGSA-N |
| XLogP | 4.83 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|