C20H32N2O2 — CID 102356628
(2R,3S)-1-benzyl-3-nitro-2-nonylpyrrolidine (PubChem CID 102356628) has the molecular formula C20H32N2O2 and a molecular weight of 332.49 g/mol. Its IUPAC name is (2R,3S)-1-benzyl-3-nitro-2-nonylpyrrolidine.
| Compound Name | (2R,3S)-1-benzyl-3-nitro-2-nonylpyrrolidine |
|---|---|
| PubChem CID | 102356628 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | (2R,3S)-1-benzyl-3-nitro-2-nonylpyrrolidine |
| SMILES | CCCCCCCCC[C@@H]1[C@@H]([N+](=O)[O-])CCN1Cc1ccccc1 |
| InChI | InChI=1S/C20H32N2O2/c1-2-3-4-5-6-7-11-14-19-20(22(23)24)15-16-21(19)17-18-12-9-8-10-13-18/h8-10,12-13,19-20H,2-7,11,14-17H2,1H3/t19-,20+/m1/s1 |
| InChIKey | DIPZEOAUCYOOQQ-UXHICEINSA-N |
| XLogP | 5.05 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|