C14H18N2O2 — CID 155414561
(2R,3S)-1-benzyl-2-cyclopropyl-3-nitropyrrolidine (PubChem CID 155414561) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is (2R,3S)-1-benzyl-2-cyclopropyl-3-nitropyrrolidine.
| Compound Name | (2R,3S)-1-benzyl-2-cyclopropyl-3-nitropyrrolidine |
|---|---|
| PubChem CID | 155414561 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | (2R,3S)-1-benzyl-2-cyclopropyl-3-nitropyrrolidine |
| SMILES | O=[N+]([O-])[C@H]1CCN(Cc2ccccc2)[C@@H]1C1CC1 |
| InChI | InChI=1S/C14H18N2O2/c17-16(18)13-8-9-15(14(13)12-6-7-12)10-11-4-2-1-3-5-11/h1-5,12-14H,6-10H2/t13-,14+/m0/s1 |
| InChIKey | LZYJIKTYYLNUBD-UONOGXRCSA-N |
| XLogP | 2.32 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|