C22H29N — CID 132517305
(1S)-1-pentyl-2-[(1S)-1-phenylethyl]-3,4-dihydro-1H-isoquinoline (PubChem CID 132517305) has the molecular formula C22H29N and a molecular weight of 307.48 g/mol. Its IUPAC name is (1S)-1-pentyl-2-[(1S)-1-phenylethyl]-3,4-dihydro-1H-isoquinoline.
| Compound Name | (1S)-1-pentyl-2-[(1S)-1-phenylethyl]-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 132517305 |
| Molecular Formula | C22H29N |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | (1S)-1-pentyl-2-[(1S)-1-phenylethyl]-3,4-dihydro-1H-isoquinoline |
| SMILES | CCCCC[C@H]1c2ccccc2CCN1[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C22H29N/c1-3-4-6-15-22-21-14-10-9-13-20(21)16-17-23(22)18(2)19-11-7-5-8-12-19/h5,7-14,18,22H,3-4,6,15-17H2,1-2H3/t18-,22-/m0/s1 |
| InChIKey | PRHCQOACTMPLOI-AVRDEDQJSA-N |
| XLogP | 5.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|