C16H21NO3 — CID 141142430
1-(4-methoxyphenyl)-3-pentylpyrrolidine-2,5-dione (PubChem CID 141142430) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-pentylpyrrolidine-2,5-dione.
| Compound Name | 1-(4-methoxyphenyl)-3-pentylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 141142430 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-pentylpyrrolidine-2,5-dione |
| SMILES | CCCCCC1CC(=O)N(c2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C16H21NO3/c1-3-4-5-6-12-11-15(18)17(16(12)19)13-7-9-14(20-2)10-8-13/h7-10,12H,3-6,11H2,1-2H3 |
| InChIKey | FYUFHNXKAZYSAY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|