C15H20N2O4 — CID 7471057
(3S)-1-(4-methoxyphenyl)-3-(3-methoxypropylamino)pyrrolidine-2,5-dione (PubChem CID 7471057) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is (3S)-1-(4-methoxyphenyl)-3-(3-methoxypropylamino)pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(4-methoxyphenyl)-3-(3-methoxypropylamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7471057 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | (3S)-1-(4-methoxyphenyl)-3-(3-methoxypropylamino)pyrrolidine-2,5-dione |
| SMILES | COCCCN[C@H]1CC(=O)N(c2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C15H20N2O4/c1-20-9-3-8-16-13-10-14(18)17(15(13)19)11-4-6-12(21-2)7-5-11/h4-7,13,16H,3,8-10H2,1-2H3/t13-/m0/s1 |
| InChIKey | YMZJUGFRYCZYCF-ZDUSSCGKSA-N |
| XLogP | 0.95 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|