C20H22N2O3 — CID 2162408
(3S)-1-(4-methoxyphenyl)-3-(3-phenylpropylamino)pyrrolidine-2,5-dione (PubChem CID 2162408) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is (3S)-1-(4-methoxyphenyl)-3-(3-phenylpropylamino)pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(4-methoxyphenyl)-3-(3-phenylpropylamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2162408 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | (3S)-1-(4-methoxyphenyl)-3-(3-phenylpropylamino)pyrrolidine-2,5-dione |
| SMILES | COc1ccc(N2C(=O)C[C@H](NCCCc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C20H22N2O3/c1-25-17-11-9-16(10-12-17)22-19(23)14-18(20(22)24)21-13-5-8-15-6-3-2-4-7-15/h2-4,6-7,9-12,18,21H,5,8,13-14H2,1H3/t18-/m0/s1 |
| InChIKey | HLFBVZFDKIDWRX-SFHVURJKSA-N |
| XLogP | 2.55 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|