C26H37NO — CID 71378075
(2R,3R)-2-decyl-1-(4-methoxyphenyl)-2-methyl-3-phenylaziridine (PubChem CID 71378075) has the molecular formula C26H37NO and a molecular weight of 379.59 g/mol. Its IUPAC name is (2R,3R)-2-decyl-1-(4-methoxyphenyl)-2-methyl-3-phenylaziridine.
| Compound Name | (2R,3R)-2-decyl-1-(4-methoxyphenyl)-2-methyl-3-phenylaziridine |
|---|---|
| PubChem CID | 71378075 |
| Molecular Formula | C26H37NO |
| Molecular Weight | 379.59 g/mol |
| Exact Mass | 379.29 |
| IUPAC Name | (2R,3R)-2-decyl-1-(4-methoxyphenyl)-2-methyl-3-phenylaziridine |
| SMILES | CCCCCCCCCC[C@]1(C)[C@@H](c2ccccc2)N1c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H37NO/c1-4-5-6-7-8-9-10-14-21-26(2)25(22-15-12-11-13-16-22)27(26)23-17-19-24(28-3)20-18-23/h11-13,15-20,25H,4-10,14,21H2,1-3H3/t25-,26-,27?/m1/s1 |
| InChIKey | LLKWVTFRNMYZHU-QMMNWOAZSA-N |
| XLogP | 7.55 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.59 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|