C18H19N — CID 15531693
(2R,3R)-2-methyl-1,3-diphenyl-2-prop-2-enylaziridine (PubChem CID 15531693) has the molecular formula C18H19N and a molecular weight of 249.36 g/mol. Its IUPAC name is (2R,3R)-2-methyl-1,3-diphenyl-2-prop-2-enylaziridine.
| Compound Name | (2R,3R)-2-methyl-1,3-diphenyl-2-prop-2-enylaziridine |
|---|---|
| PubChem CID | 15531693 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | (2R,3R)-2-methyl-1,3-diphenyl-2-prop-2-enylaziridine |
| SMILES | C=CC[C@]1(C)[C@@H](c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C18H19N/c1-3-14-18(2)17(15-10-6-4-7-11-15)19(18)16-12-8-5-9-13-16/h3-13,17H,1,14H2,2H3/t17-,18-,19?/m1/s1 |
| InChIKey | SAKNYSFUOJZMOS-PWCSWUJKSA-N |
| XLogP | 4.58 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|