C23H22N2O3 — CID 67259479
5-but-2-enyl-1,3-diphenyl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione (PubChem CID 67259479) has the molecular formula C23H22N2O3 and a molecular weight of 374.44 g/mol. Its IUPAC name is 5-but-2-enyl-1,3-diphenyl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-but-2-enyl-1,3-diphenyl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 67259479 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 5-but-2-enyl-1,3-diphenyl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCC1(CC=CC)C(=O)N(c2ccccc2)C(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C23H22N2O3/c1-3-5-17-23(16-4-2)20(26)24(18-12-8-6-9-13-18)22(28)25(21(23)27)19-14-10-7-11-15-19/h3-15H,2,16-17H2,1H3 |
| InChIKey | BJVKCRRJAAFZHI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|