About 2-chloro-2-fluoro-1,3-diphenylaziridine
2-chloro-2-fluoro-1,3-diphenylaziridine (PubChem CID 23265826) has the molecular formula C14H11ClFN
and a molecular weight of 247.70 g/mol. Its IUPAC name is 2-chloro-2-fluoro-1,3-diphenylaziridine.
Molecular Properties
| Compound Name | 2-chloro-2-fluoro-1,3-diphenylaziridine |
| PubChem CID | 23265826 |
| Molecular Formula | C14H11ClFN |
| Molecular Weight | 247.70 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 2-chloro-2-fluoro-1,3-diphenylaziridine |
| SMILES | FC1(Cl)C(c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C14H11ClFN/c15-14(16)13(11-7-3-1-4-8-11)17(14)12-9-5-2-6-10-12/h1-10,13H |
| InChIKey | DFSMZBXBQOVAJB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.70 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-2-fluoro-1,3-diphenylaziridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-2-fluoro-1,3-diphenylaziridine?
The IUPAC name of 2-chloro-2-fluoro-1,3-diphenylaziridine (CID 23265826) is 2-chloro-2-fluoro-1,3-diphenylaziridine.
What is the SMILES notation for 2-chloro-2-fluoro-1,3-diphenylaziridine?
The canonical SMILES for 2-chloro-2-fluoro-1,3-diphenylaziridine is FC1(Cl)C(c2ccccc2)N1c1ccccc1.
What is the InChIKey of 2-chloro-2-fluoro-1,3-diphenylaziridine?
The InChIKey is DFSMZBXBQOVAJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11ClFN/c15-14(16)13(11-7-3-1-4-8-11)17(14)12-9-5-2-6-10-12/h1-10,13H.
What are the key properties of 2-chloro-2-fluoro-1,3-diphenylaziridine?
2-chloro-2-fluoro-1,3-diphenylaziridine has a molecular weight of 247.70 g/mol, XLogP of 4.11, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-2-fluoro-1,3-diphenylaziridine is sourced from PubChem (CID 23265826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).