C22H19NOS — CID 162406085
(3R,4R)-3-methylsulfanyl-1,3,4-triphenylazetidin-2-one (PubChem CID 162406085) has the molecular formula C22H19NOS and a molecular weight of 345.47 g/mol. Its IUPAC name is (3R,4R)-3-methylsulfanyl-1,3,4-triphenylazetidin-2-one.
| Compound Name | (3R,4R)-3-methylsulfanyl-1,3,4-triphenylazetidin-2-one |
|---|---|
| PubChem CID | 162406085 |
| Molecular Formula | C22H19NOS |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | (3R,4R)-3-methylsulfanyl-1,3,4-triphenylazetidin-2-one |
| SMILES | CS[C@@]1(c2ccccc2)C(=O)N(c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H19NOS/c1-25-22(18-13-7-3-8-14-18)20(17-11-5-2-6-12-17)23(21(22)24)19-15-9-4-10-16-19/h2-16,20H,1H3/t20-,22-/m1/s1 |
| InChIKey | VKGSOTNQCALMRB-IFMALSPDSA-N |
| XLogP | 5.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |