C25H24N2O2S — CID 11069756
S-[(2S,3R)-2-methyl-4-oxo-1,3-diphenylazetidin-3-yl] N-benzyl-N-methylcarbamothioate (PubChem CID 11069756) has the molecular formula C25H24N2O2S and a molecular weight of 416.55 g/mol. Its IUPAC name is S-[(2S,3R)-2-methyl-4-oxo-1,3-diphenylazetidin-3-yl] N-benzyl-N-methylcarbamothioate.
| Compound Name | S-[(2S,3R)-2-methyl-4-oxo-1,3-diphenylazetidin-3-yl] N-benzyl-N-methylcarbamothioate |
|---|---|
| PubChem CID | 11069756 |
| Molecular Formula | C25H24N2O2S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | S-[(2S,3R)-2-methyl-4-oxo-1,3-diphenylazetidin-3-yl] N-benzyl-N-methylcarbamothioate |
| SMILES | C[C@@H]1N(c2ccccc2)C(=O)[C@@]1(SC(=O)N(C)Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H24N2O2S/c1-19-25(21-14-8-4-9-15-21,23(28)27(19)22-16-10-5-11-17-22)30-24(29)26(2)18-20-12-6-3-7-13-20/h3-17,19H,18H2,1-2H3/t19-,25-/m0/s1 |
| InChIKey | HKHAMWMMHSLHDK-DFBJGRDBSA-N |
| XLogP | 5.30 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|