C24H20F10N2O2 — CID 5018753
1-N,4-N-dibenzyl-1,2,2,3,3,4,5,5,6,6-decafluoro-1-N,4-N-dimethylcyclohexane-1,4-dicarboxamide (PubChem CID 5018753) has the molecular formula C24H20F10N2O2 and a molecular weight of 558.42 g/mol. Its IUPAC name is 1-N,4-N-dibenzyl-1,2,2,3,3,4,5,5,6,6-decafluoro-1-N,4-N-dimethylcyclohexane-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-dibenzyl-1,2,2,3,3,4,5,5,6,6-decafluoro-1-N,4-N-dimethylcyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 5018753 |
| Molecular Formula | C24H20F10N2O2 |
| Molecular Weight | 558.42 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | 1-N,4-N-dibenzyl-1,2,2,3,3,4,5,5,6,6-decafluoro-1-N,4-N-dimethylcyclohexane-1,4-dicarboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)C1(F)C(F)(F)C(F)(F)C(F)(C(=O)N(C)Cc2ccccc2)C(F)(F)C1(F)F |
| InChI | InChI=1S/C24H20F10N2O2/c1-35(13-15-9-5-3-6-10-15)17(37)19(25)21(27,28)23(31,32)20(26,24(33,34)22(19,29)30)18(38)36(2)14-16-11-7-4-8-12-16/h3-12H,13-14H2,1-2H3 |
| InChIKey | ZZUOQKYMTZSYRU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.42 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|