C26H25N3O3 — CID 2104262
(2S)-N-benzyl-2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-methylpropanamide (PubChem CID 2104262) has the molecular formula C26H25N3O3 and a molecular weight of 427.50 g/mol. Its IUPAC name is (2S)-N-benzyl-2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-methylpropanamide.
| Compound Name | (2S)-N-benzyl-2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-methylpropanamide |
|---|---|
| PubChem CID | 2104262 |
| Molecular Formula | C26H25N3O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | (2S)-N-benzyl-2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-methylpropanamide |
| SMILES | C[C@@H](C(=O)N(C)Cc1ccccc1)N1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C26H25N3O3/c1-19(23(30)28(2)18-20-12-6-3-7-13-20)29-24(31)26(27-25(29)32,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-17,19H,18H2,1-2H3,(H,27,32)/t19-/m0/s1 |
| InChIKey | JPBKBZZCVYUFSR-IBGZPJMESA-N |
| XLogP | 3.53 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|