C25H20F3N3O3 — CID 5033409
2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 5033409) has the molecular formula C25H20F3N3O3 and a molecular weight of 467.45 g/mol. Its IUPAC name is 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 5033409 |
| Molecular Formula | C25H20F3N3O3 |
| Molecular Weight | 467.45 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(C(=O)Nc1cccc(C(F)(F)F)c1)N1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C25H20F3N3O3/c1-16(21(32)29-20-14-8-13-19(15-20)25(26,27)28)31-22(33)24(30-23(31)34,17-9-4-2-5-10-17)18-11-6-3-7-12-18/h2-16H,1H3,(H,29,32)(H,30,34) |
| InChIKey | FXIWKINXOCAVMW-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|