C31H29NO — CID 156769472
1-(4-tert-butylphenyl)-3,3,4-triphenylazetidin-2-one (PubChem CID 156769472) has the molecular formula C31H29NO and a molecular weight of 431.58 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3,3,4-triphenylazetidin-2-one.
| Compound Name | 1-(4-tert-butylphenyl)-3,3,4-triphenylazetidin-2-one |
|---|---|
| PubChem CID | 156769472 |
| Molecular Formula | C31H29NO |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3,3,4-triphenylazetidin-2-one |
| SMILES | CC(C)(C)c1ccc(N2C(=O)C(c3ccccc3)(c3ccccc3)C2c2ccccc2)cc1 |
| InChI | InChI=1S/C31H29NO/c1-30(2,3)24-19-21-27(22-20-24)32-28(23-13-7-4-8-14-23)31(29(32)33,25-15-9-5-10-16-25)26-17-11-6-12-18-26/h4-22,28H,1-3H3 |
| InChIKey | GURZGSOYPDMOCT-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |