C20H20ClNO3 — CID 602670
tert-butyl 3-chloro-2-oxo-1,4-diphenylazetidine-3-carboxylate (PubChem CID 602670) has the molecular formula C20H20ClNO3 and a molecular weight of 357.84 g/mol. Its IUPAC name is tert-butyl 3-chloro-2-oxo-1,4-diphenylazetidine-3-carboxylate.
| Compound Name | tert-butyl 3-chloro-2-oxo-1,4-diphenylazetidine-3-carboxylate |
|---|---|
| PubChem CID | 602670 |
| Molecular Formula | C20H20ClNO3 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | tert-butyl 3-chloro-2-oxo-1,4-diphenylazetidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(Cl)C(=O)N(c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C20H20ClNO3/c1-19(2,3)25-18(24)20(21)16(14-10-6-4-7-11-14)22(17(20)23)15-12-8-5-9-13-15/h4-13,16H,1-3H3 |
| InChIKey | HUDLWMAPXSGMQT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|