C17H15NO4 — CID 102070722
methyl 3-hydroxy-2-oxo-1,4-diphenylazetidine-3-carboxylate (PubChem CID 102070722) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is methyl 3-hydroxy-2-oxo-1,4-diphenylazetidine-3-carboxylate.
| Compound Name | methyl 3-hydroxy-2-oxo-1,4-diphenylazetidine-3-carboxylate |
|---|---|
| PubChem CID | 102070722 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | methyl 3-hydroxy-2-oxo-1,4-diphenylazetidine-3-carboxylate |
| SMILES | COC(=O)C1(O)C(=O)N(c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C17H15NO4/c1-22-16(20)17(21)14(12-8-4-2-5-9-12)18(15(17)19)13-10-6-3-7-11-13/h2-11,14,21H,1H3 |
| InChIKey | AWOBZGATKWZHHC-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|