C19H14Cl3NO3 — CID 134919381
methyl 2-oxo-1,4-diphenyl-3-(1,2,2-trichloroethenyl)azetidine-3-carboxylate (PubChem CID 134919381) has the molecular formula C19H14Cl3NO3 and a molecular weight of 410.68 g/mol. Its IUPAC name is methyl 2-oxo-1,4-diphenyl-3-(1,2,2-trichloroethenyl)azetidine-3-carboxylate.
| Compound Name | methyl 2-oxo-1,4-diphenyl-3-(1,2,2-trichloroethenyl)azetidine-3-carboxylate |
|---|---|
| PubChem CID | 134919381 |
| Molecular Formula | C19H14Cl3NO3 |
| Molecular Weight | 410.68 g/mol |
| Exact Mass | 409.00 |
| IUPAC Name | methyl 2-oxo-1,4-diphenyl-3-(1,2,2-trichloroethenyl)azetidine-3-carboxylate |
| SMILES | COC(=O)C1(C(Cl)=C(Cl)Cl)C(=O)N(c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C19H14Cl3NO3/c1-26-18(25)19(14(20)16(21)22)15(12-8-4-2-5-9-12)23(17(19)24)13-10-6-3-7-11-13/h2-11,15H,1H3 |
| InChIKey | WWEFAZRYRNRIIG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.68 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|