C25H24N2O2 — CID 11003531
N-[(3R,4R)-2-oxo-1,4-diphenyl-3-propan-2-ylazetidin-3-yl]benzamide (PubChem CID 11003531) has the molecular formula C25H24N2O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is N-[(3R,4R)-2-oxo-1,4-diphenyl-3-propan-2-ylazetidin-3-yl]benzamide.
| Compound Name | N-[(3R,4R)-2-oxo-1,4-diphenyl-3-propan-2-ylazetidin-3-yl]benzamide |
|---|---|
| PubChem CID | 11003531 |
| Molecular Formula | C25H24N2O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | N-[(3R,4R)-2-oxo-1,4-diphenyl-3-propan-2-ylazetidin-3-yl]benzamide |
| SMILES | CC(C)[C@]1(NC(=O)c2ccccc2)C(=O)N(c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C25H24N2O2/c1-18(2)25(26-23(28)20-14-8-4-9-15-20)22(19-12-6-3-7-13-19)27(24(25)29)21-16-10-5-11-17-21/h3-18,22H,1-2H3,(H,26,28)/t22-,25-/m1/s1 |
| InChIKey | ZVOBDEFZNDFFLX-RCZVLFRGSA-N |
| XLogP | 4.60 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |