C28H26N2O4 — CID 101340671
methyl (1S,4R,5R,6S,7R)-4-benzamido-4-methyl-3-oxo-2,5-diphenyl-2-azabicyclo[4.1.0]heptane-7-carboxylate (PubChem CID 101340671) has the molecular formula C28H26N2O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is methyl (1S,4R,5R,6S,7R)-4-benzamido-4-methyl-3-oxo-2,5-diphenyl-2-azabicyclo[4.1.0]heptane-7-carboxylate.
| Compound Name | methyl (1S,4R,5R,6S,7R)-4-benzamido-4-methyl-3-oxo-2,5-diphenyl-2-azabicyclo[4.1.0]heptane-7-carboxylate |
|---|---|
| PubChem CID | 101340671 |
| Molecular Formula | C28H26N2O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | methyl (1S,4R,5R,6S,7R)-4-benzamido-4-methyl-3-oxo-2,5-diphenyl-2-azabicyclo[4.1.0]heptane-7-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2[C@@H]1N(c1ccccc1)C(=O)[C@](C)(NC(=O)c1ccccc1)[C@H]2c1ccccc1 |
| InChI | InChI=1S/C28H26N2O4/c1-28(29-25(31)19-14-8-4-9-15-19)23(18-12-6-3-7-13-18)21-22(26(32)34-2)24(21)30(27(28)33)20-16-10-5-11-17-20/h3-17,21-24H,1-2H3,(H,29,31)/t21-,22-,23+,24+,28-/m1/s1 |
| InChIKey | KJYGVXUJWFLDGX-USHMZBSOSA-N |
| XLogP | 3.79 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |