C24H32N2O4 — CID 101340670
ethyl (1S,4R,5S,6S,7S)-4-benzamido-2-cyclohexyl-4,5-dimethyl-3-oxo-2-azabicyclo[4.1.0]heptane-7-carboxylate (PubChem CID 101340670) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is ethyl (1S,4R,5S,6S,7S)-4-benzamido-2-cyclohexyl-4,5-dimethyl-3-oxo-2-azabicyclo[4.1.0]heptane-7-carboxylate.
| Compound Name | ethyl (1S,4R,5S,6S,7S)-4-benzamido-2-cyclohexyl-4,5-dimethyl-3-oxo-2-azabicyclo[4.1.0]heptane-7-carboxylate |
|---|---|
| PubChem CID | 101340670 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | ethyl (1S,4R,5S,6S,7S)-4-benzamido-2-cyclohexyl-4,5-dimethyl-3-oxo-2-azabicyclo[4.1.0]heptane-7-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H]2[C@@H]1N(C1CCCCC1)C(=O)[C@](C)(NC(=O)c1ccccc1)[C@H]2C |
| InChI | InChI=1S/C24H32N2O4/c1-4-30-22(28)19-18-15(2)24(3,25-21(27)16-11-7-5-8-12-16)23(29)26(20(18)19)17-13-9-6-10-14-17/h5,7-8,11-12,15,17-20H,4,6,9-10,13-14H2,1-3H3,(H,25,27)/t15-,18-,19-,20-,24+/m0/s1 |
| InChIKey | OGDCNDWAGCYLRV-WUUKAAGISA-N |
| XLogP | 3.16 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |