C22H29N3O5 — CID 7832466
diethyl (2S,3R,4E)-1-cyclohexyl-5-oxo-4-(phenylhydrazinylidene)pyrrolidine-2,3-dicarboxylate (PubChem CID 7832466) has the molecular formula C22H29N3O5 and a molecular weight of 415.49 g/mol. Its IUPAC name is diethyl (2S,3R,4E)-1-cyclohexyl-5-oxo-4-(phenylhydrazinylidene)pyrrolidine-2,3-dicarboxylate.
| Compound Name | diethyl (2S,3R,4E)-1-cyclohexyl-5-oxo-4-(phenylhydrazinylidene)pyrrolidine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 7832466 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | diethyl (2S,3R,4E)-1-cyclohexyl-5-oxo-4-(phenylhydrazinylidene)pyrrolidine-2,3-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](C(=O)OCC)/C(=N\Nc2ccccc2)C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C22H29N3O5/c1-3-29-21(27)17-18(24-23-15-11-7-5-8-12-15)20(26)25(16-13-9-6-10-14-16)19(17)22(28)30-4-2/h5,7-8,11-12,16-17,19,23H,3-4,6,9-10,13-14H2,1-2H3/b24-18+/t17-,19-/m0/s1 |
| InChIKey | SMOAHKZRNLEGLU-ZKQNKQRDSA-N |
| XLogP | 2.74 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|