C24H28N4O4 — CID 26475706
trans-diethyl (1R,2E,4R,5Z)-2,5-bis(phenylhydrazinylidene)cyclohexane-1,4-dicarboxylate (PubChem CID 26475706) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is trans-diethyl (1R,2E,4R,5Z)-2,5-bis(phenylhydrazinylidene)cyclohexane-1,4-dicarboxylate.
| Compound Name | trans-diethyl (1R,2E,4R,5Z)-2,5-bis(phenylhydrazinylidene)cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 26475706 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | trans-diethyl (1R,2E,4R,5Z)-2,5-bis(phenylhydrazinylidene)cyclohexane-1,4-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1C/C(=N\Nc2ccccc2)[C@H](C(=O)OCC)C/C1=N/Nc1ccccc1 |
| InChI | InChI=1S/C24H28N4O4/c1-3-31-23(29)19-15-22(28-26-18-13-9-6-10-14-18)20(24(30)32-4-2)16-21(19)27-25-17-11-7-5-8-12-17/h5-14,19-20,25-26H,3-4,15-16H2,1-2H3/b27-21-,28-22+/t19-,20-/m1/s1 |
| InChIKey | LUZLKCUFEJJPFR-LPCYTTHXSA-N |
| XLogP | 4.07 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|