C12H13NO4 — CID 13150800
ethyl 3-(phenylcarbamoyl)oxirane-2-carboxylate (PubChem CID 13150800) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is ethyl 3-(phenylcarbamoyl)oxirane-2-carboxylate.
| Compound Name | ethyl 3-(phenylcarbamoyl)oxirane-2-carboxylate |
|---|---|
| PubChem CID | 13150800 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | ethyl 3-(phenylcarbamoyl)oxirane-2-carboxylate |
| SMILES | CCOC(=O)C1OC1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C12H13NO4/c1-2-16-12(15)10-9(17-10)11(14)13-8-6-4-3-5-7-8/h3-7,9-10H,2H2,1H3,(H,13,14) |
| InChIKey | HTZXQIOCUBKYAC-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|