C17H19NO5 — CID 92529663
cis-diethyl (1R,3S)-4-oxo-5-phenyliminocyclopentane-1,3-dicarboxylate (PubChem CID 92529663) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is cis-diethyl (1R,3S)-4-oxo-5-phenyliminocyclopentane-1,3-dicarboxylate.
| Compound Name | cis-diethyl (1R,3S)-4-oxo-5-phenyliminocyclopentane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 92529663 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | cis-diethyl (1R,3S)-4-oxo-5-phenyliminocyclopentane-1,3-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@@H](C(=O)OCC)/C(=N/c2ccccc2)C1=O |
| InChI | InChI=1S/C17H19NO5/c1-3-22-16(20)12-10-13(17(21)23-4-2)15(19)14(12)18-11-8-6-5-7-9-11/h5-9,12-13H,3-4,10H2,1-2H3/b18-14-/t12-,13+/m1/s1 |
| InChIKey | BCXHWLRGPPABRC-PWCSFYDTSA-N |
| XLogP | 2.09 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|