C18H16N2O2S — CID 101013302
ethyl 3,4-bis(phenylimino)thietane-2-carboxylate (PubChem CID 101013302) has the molecular formula C18H16N2O2S and a molecular weight of 324.41 g/mol. Its IUPAC name is ethyl 3,4-bis(phenylimino)thietane-2-carboxylate.
| Compound Name | ethyl 3,4-bis(phenylimino)thietane-2-carboxylate |
|---|---|
| PubChem CID | 101013302 |
| Molecular Formula | C18H16N2O2S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | ethyl 3,4-bis(phenylimino)thietane-2-carboxylate |
| SMILES | CCOC(=O)C1SC(=N\c2ccccc2)/C1=N/c1ccccc1 |
| InChI | InChI=1S/C18H16N2O2S/c1-2-22-18(21)16-15(19-13-9-5-3-6-10-13)17(23-16)20-14-11-7-4-8-12-14/h3-12,16H,2H2,1H3/b19-15+,20-17- |
| InChIKey | MEUHVJNLWBUIKC-YKZVWFMFSA-N |
| XLogP | 4.17 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|