About acetic acid;ethyl 1H-indene-1-carboxylate
acetic acid;ethyl 1H-indene-1-carboxylate (PubChem CID 174482190) has the molecular formula C14H16O4
and a molecular weight of 248.28 g/mol. Its IUPAC name is acetic acid;ethyl 1H-indene-1-carboxylate.
Molecular Properties
| Compound Name | acetic acid;ethyl 1H-indene-1-carboxylate |
| PubChem CID | 174482190 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | acetic acid;ethyl 1H-indene-1-carboxylate |
| SMILES | CC(=O)O.CCOC(=O)C1C=Cc2ccccc21 |
| InChI | InChI=1S/C12H12O2.C2H4O2/c1-2-14-12(13)11-8-7-9-5-3-4-6-10(9)11;1-2(3)4/h3-8,11H,2H2,1H3;1H3,(H,3,4) |
| InChIKey | BYZNYDABFDMNJR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetic acid;ethyl 1H-indene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;ethyl 1H-indene-1-carboxylate?
The IUPAC name of acetic acid;ethyl 1H-indene-1-carboxylate (CID 174482190) is acetic acid;ethyl 1H-indene-1-carboxylate.
What is the SMILES notation for acetic acid;ethyl 1H-indene-1-carboxylate?
The canonical SMILES for acetic acid;ethyl 1H-indene-1-carboxylate is CC(=O)O.CCOC(=O)C1C=Cc2ccccc21.
What is the InChIKey of acetic acid;ethyl 1H-indene-1-carboxylate?
The InChIKey is BYZNYDABFDMNJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O2.C2H4O2/c1-2-14-12(13)11-8-7-9-5-3-4-6-10(9)11;1-2(3)4/h3-8,11H,2H2,1H3;1H3,(H,3,4).
What are the key properties of acetic acid;ethyl 1H-indene-1-carboxylate?
acetic acid;ethyl 1H-indene-1-carboxylate has a molecular weight of 248.28 g/mol, XLogP of 2.45, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;ethyl 1H-indene-1-carboxylate is sourced from PubChem (CID 174482190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).