C12H9F2O5S- — CID 162462028
1,1-difluoro-2-(1H-indene-1-carbonyloxy)ethanesulfonate (PubChem CID 162462028) has the molecular formula C12H9F2O5S- and a molecular weight of 303.26 g/mol. Its IUPAC name is 1,1-difluoro-2-(1H-indene-1-carbonyloxy)ethanesulfonate.
| Compound Name | 1,1-difluoro-2-(1H-indene-1-carbonyloxy)ethanesulfonate |
|---|---|
| PubChem CID | 162462028 |
| Molecular Formula | C12H9F2O5S- |
| Molecular Weight | 303.26 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 1,1-difluoro-2-(1H-indene-1-carbonyloxy)ethanesulfonate |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)[O-])C1C=Cc2ccccc21 |
| InChI | InChI=1S/C12H10F2O5S/c13-12(14,20(16,17)18)7-19-11(15)10-6-5-8-3-1-2-4-9(8)10/h1-6,10H,7H2,(H,16,17,18)/p-1 |
| InChIKey | RKNMJYQXUAEBCU-UHFFFAOYSA-M |
| XLogP | 1.48 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|