C24H23F2O5PS — CID 161059869
1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethanesulfonate;triphenylphosphanium (PubChem CID 161059869) has the molecular formula C24H23F2O5PS and a molecular weight of 492.48 g/mol. Its IUPAC name is 1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethanesulfonate;triphenylphosphanium.
| Compound Name | 1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethanesulfonate;triphenylphosphanium |
|---|---|
| PubChem CID | 161059869 |
| Molecular Formula | C24H23F2O5PS |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | 1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethanesulfonate;triphenylphosphanium |
| SMILES | C=C(C)C(=O)OCC(F)(F)S(=O)(=O)[O-].c1ccc([PH+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C6H8F2O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-4(2)5(9)13-3-6(7,8)14(10,11)12/h1-15H;1,3H2,2H3,(H,10,11,12) |
| InChIKey | UDGICOWXOTUCOH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|