C24H20F2O5S2 — CID 86667400
1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethanesulfonate;1-phenyldibenzothiophen-5-ium (PubChem CID 86667400) has the molecular formula C24H20F2O5S2 and a molecular weight of 490.55 g/mol. Its IUPAC name is 1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethanesulfonate;1-phenyldibenzothiophen-5-ium.
| Compound Name | 1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethanesulfonate;1-phenyldibenzothiophen-5-ium |
|---|---|
| PubChem CID | 86667400 |
| Molecular Formula | C24H20F2O5S2 |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.07 |
| IUPAC Name | 1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethanesulfonate;1-phenyldibenzothiophen-5-ium |
| SMILES | C=C(C)C(=O)OCC(F)(F)S(=O)(=O)[O-].c1ccc(-c2cccc3[sH+]c4ccccc4c23)cc1 |
| InChI | InChI=1S/C18H12S.C6H8F2O5S/c1-2-7-13(8-3-1)14-10-6-12-17-18(14)15-9-4-5-11-16(15)19-17;1-4(2)5(9)13-3-6(7,8)14(10,11)12/h1-12H;1,3H2,2H3,(H,10,11,12) |
| InChIKey | XWRLFRAERDBKFQ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|