C22H25F2IO5S — CID 173381208
1-tert-butyl-2-(2-iodophenyl)benzene;1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethanesulfonic acid (PubChem CID 173381208) has the molecular formula C22H25F2IO5S and a molecular weight of 566.40 g/mol. Its IUPAC name is 1-tert-butyl-2-(2-iodophenyl)benzene;1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethanesulfonic acid.
| Compound Name | 1-tert-butyl-2-(2-iodophenyl)benzene;1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethanesulfonic acid |
|---|---|
| PubChem CID | 173381208 |
| Molecular Formula | C22H25F2IO5S |
| Molecular Weight | 566.40 g/mol |
| Exact Mass | 566.04 |
| IUPAC Name | 1-tert-butyl-2-(2-iodophenyl)benzene;1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethanesulfonic acid |
| SMILES | C=C(C)C(=O)OCC(F)(F)S(=O)(=O)O.CC(C)(C)c1ccccc1-c1ccccc1I |
| InChI | InChI=1S/C16H17I.C6H8F2O5S/c1-16(2,3)14-10-6-4-8-12(14)13-9-5-7-11-15(13)17;1-4(2)5(9)13-3-6(7,8)14(10,11)12/h4-11H,1-3H3;1,3H2,2H3,(H,10,11,12) |
| InChIKey | OIVQMQRBAJXNQY-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.40 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|