C17H18F3IO4S — CID 173153086
1-iodo-2-[2-[(2-methylpropan-2-yl)oxy]phenyl]benzene;trifluoromethanesulfonic acid (PubChem CID 173153086) has the molecular formula C17H18F3IO4S and a molecular weight of 502.29 g/mol. Its IUPAC name is 1-iodo-2-[2-[(2-methylpropan-2-yl)oxy]phenyl]benzene;trifluoromethanesulfonic acid.
| Compound Name | 1-iodo-2-[2-[(2-methylpropan-2-yl)oxy]phenyl]benzene;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 173153086 |
| Molecular Formula | C17H18F3IO4S |
| Molecular Weight | 502.29 g/mol |
| Exact Mass | 501.99 |
| IUPAC Name | 1-iodo-2-[2-[(2-methylpropan-2-yl)oxy]phenyl]benzene;trifluoromethanesulfonic acid |
| SMILES | CC(C)(C)Oc1ccccc1-c1ccccc1I.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C16H17IO.CHF3O3S/c1-16(2,3)18-15-11-7-5-9-13(15)12-8-4-6-10-14(12)17;2-1(3,4)8(5,6)7/h4-11H,1-3H3;(H,5,6,7) |
| InChIKey | IHFIUNSCKJBDDY-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.29 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|