About 1-iodo-2-(4-nitrophenyl)benzene;trifluoromethanesulfonic acid
1-iodo-2-(4-nitrophenyl)benzene;trifluoromethanesulfonic acid (PubChem CID 159985254) has the molecular formula C13H9F3INO5S
and a molecular weight of 475.18 g/mol. Its IUPAC name is 1-iodo-2-(4-nitrophenyl)benzene;trifluoromethanesulfonic acid.
Molecular Properties
| Compound Name | 1-iodo-2-(4-nitrophenyl)benzene;trifluoromethanesulfonic acid |
| PubChem CID | 159985254 |
| Molecular Formula | C13H9F3INO5S |
| Molecular Weight | 475.18 g/mol |
| Exact Mass | 474.92 |
| IUPAC Name | 1-iodo-2-(4-nitrophenyl)benzene;trifluoromethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)F.O=[N+]([O-])c1ccc(-c2ccccc2I)cc1 |
| InChI | InChI=1S/C12H8INO2.CHF3O3S/c13-12-4-2-1-3-11(12)9-5-7-10(8-6-9)14(15)16;2-1(3,4)8(5,6)7/h1-8H;(H,5,6,7) |
| InChIKey | OGGFJQPCOJOMCG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 475.18 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-2-(4-nitrophenyl)benzene;trifluoromethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-2-(4-nitrophenyl)benzene;trifluoromethanesulfonic acid?
The IUPAC name of 1-iodo-2-(4-nitrophenyl)benzene;trifluoromethanesulfonic acid (CID 159985254) is 1-iodo-2-(4-nitrophenyl)benzene;trifluoromethanesulfonic acid.
What is the SMILES notation for 1-iodo-2-(4-nitrophenyl)benzene;trifluoromethanesulfonic acid?
The canonical SMILES for 1-iodo-2-(4-nitrophenyl)benzene;trifluoromethanesulfonic acid is O=S(=O)(O)C(F)(F)F.O=[N+]([O-])c1ccc(-c2ccccc2I)cc1.
What is the InChIKey of 1-iodo-2-(4-nitrophenyl)benzene;trifluoromethanesulfonic acid?
The InChIKey is OGGFJQPCOJOMCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8INO2.CHF3O3S/c13-12-4-2-1-3-11(12)9-5-7-10(8-6-9)14(15)16;2-1(3,4)8(5,6)7/h1-8H;(H,5,6,7).
What are the key properties of 1-iodo-2-(4-nitrophenyl)benzene;trifluoromethanesulfonic acid?
1-iodo-2-(4-nitrophenyl)benzene;trifluoromethanesulfonic acid has a molecular weight of 475.18 g/mol, XLogP of 4.26, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-2-(4-nitrophenyl)benzene;trifluoromethanesulfonic acid is sourced from PubChem (CID 159985254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).