C11H15F3O4S2 — CID 171923746
4-[(2-methylpropan-2-yl)oxy]benzenethiol;trifluoromethanesulfonic acid (PubChem CID 171923746) has the molecular formula C11H15F3O4S2 and a molecular weight of 332.37 g/mol. Its IUPAC name is 4-[(2-methylpropan-2-yl)oxy]benzenethiol;trifluoromethanesulfonic acid.
| Compound Name | 4-[(2-methylpropan-2-yl)oxy]benzenethiol;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 171923746 |
| Molecular Formula | C11H15F3O4S2 |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 4-[(2-methylpropan-2-yl)oxy]benzenethiol;trifluoromethanesulfonic acid |
| SMILES | CC(C)(C)Oc1ccc(S)cc1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C10H14OS.CHF3O3S/c1-10(2,3)11-8-4-6-9(12)7-5-8;2-1(3,4)8(5,6)7/h4-7,12H,1-3H3;(H,5,6,7) |
| InChIKey | VHOFVVVYAFDUSX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|