About naphthalene-2-thiol;trifluoromethanesulfonic acid
naphthalene-2-thiol;trifluoromethanesulfonic acid (PubChem CID 162622443) has the molecular formula C11H9F3O3S2
and a molecular weight of 310.32 g/mol. Its IUPAC name is naphthalene-2-thiol;trifluoromethanesulfonic acid.
Molecular Properties
| Compound Name | naphthalene-2-thiol;trifluoromethanesulfonic acid |
| PubChem CID | 162622443 |
| Molecular Formula | C11H9F3O3S2 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | naphthalene-2-thiol;trifluoromethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)F.Sc1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8S.CHF3O3S/c11-10-6-5-8-3-1-2-4-9(8)7-10;2-1(3,4)8(5,6)7/h1-7,11H;(H,5,6,7) |
| InChIKey | XORLRZKFJUQCMM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze naphthalene-2-thiol;trifluoromethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene-2-thiol;trifluoromethanesulfonic acid?
The IUPAC name of naphthalene-2-thiol;trifluoromethanesulfonic acid (CID 162622443) is naphthalene-2-thiol;trifluoromethanesulfonic acid.
What is the SMILES notation for naphthalene-2-thiol;trifluoromethanesulfonic acid?
The canonical SMILES for naphthalene-2-thiol;trifluoromethanesulfonic acid is O=S(=O)(O)C(F)(F)F.Sc1ccc2ccccc2c1.
What is the InChIKey of naphthalene-2-thiol;trifluoromethanesulfonic acid?
The InChIKey is XORLRZKFJUQCMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8S.CHF3O3S/c11-10-6-5-8-3-1-2-4-9(8)7-10;2-1(3,4)8(5,6)7/h1-7,11H;(H,5,6,7).
What are the key properties of naphthalene-2-thiol;trifluoromethanesulfonic acid?
naphthalene-2-thiol;trifluoromethanesulfonic acid has a molecular weight of 310.32 g/mol, XLogP of 3.52, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene-2-thiol;trifluoromethanesulfonic acid is sourced from PubChem (CID 162622443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).