About naphthalene-2-thiol;propan-1-amine
naphthalene-2-thiol;propan-1-amine (PubChem CID 162435108) has the molecular formula C13H17NS
and a molecular weight of 219.35 g/mol. Its IUPAC name is naphthalene-2-thiol;propan-1-amine.
Molecular Properties
| Compound Name | naphthalene-2-thiol;propan-1-amine |
| PubChem CID | 162435108 |
| Molecular Formula | C13H17NS |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | naphthalene-2-thiol;propan-1-amine |
| SMILES | CCCN.Sc1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8S.C3H9N/c11-10-6-5-8-3-1-2-4-9(8)7-10;1-2-3-4/h1-7,11H;2-4H2,1H3 |
| InChIKey | GRUYBZFNCBJSLU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze naphthalene-2-thiol;propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene-2-thiol;propan-1-amine?
The IUPAC name of naphthalene-2-thiol;propan-1-amine (CID 162435108) is naphthalene-2-thiol;propan-1-amine.
What is the SMILES notation for naphthalene-2-thiol;propan-1-amine?
The canonical SMILES for naphthalene-2-thiol;propan-1-amine is CCCN.Sc1ccc2ccccc2c1.
What is the InChIKey of naphthalene-2-thiol;propan-1-amine?
The InChIKey is GRUYBZFNCBJSLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8S.C3H9N/c11-10-6-5-8-3-1-2-4-9(8)7-10;1-2-3-4/h1-7,11H;2-4H2,1H3.
What are the key properties of naphthalene-2-thiol;propan-1-amine?
naphthalene-2-thiol;propan-1-amine has a molecular weight of 219.35 g/mol, XLogP of 3.48, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene-2-thiol;propan-1-amine is sourced from PubChem (CID 162435108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).