About butane;naphthalen-2-ylphosphane
butane;naphthalen-2-ylphosphane (PubChem CID 174828877) has the molecular formula C14H19P
and a molecular weight of 218.28 g/mol. Its IUPAC name is butane;naphthalen-2-ylphosphane.
Molecular Properties
| Compound Name | butane;naphthalen-2-ylphosphane |
| PubChem CID | 174828877 |
| Molecular Formula | C14H19P |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | butane;naphthalen-2-ylphosphane |
| SMILES | CCCC.Pc1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H9P.C4H10/c11-10-6-5-8-3-1-2-4-9(8)7-10;1-3-4-2/h1-7H,11H2;3-4H2,1-2H3 |
| InChIKey | VCDVNPUVHNXKAP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze butane;naphthalen-2-ylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;naphthalen-2-ylphosphane?
The IUPAC name of butane;naphthalen-2-ylphosphane (CID 174828877) is butane;naphthalen-2-ylphosphane.
What is the SMILES notation for butane;naphthalen-2-ylphosphane?
The canonical SMILES for butane;naphthalen-2-ylphosphane is CCCC.Pc1ccc2ccccc2c1.
What is the InChIKey of butane;naphthalen-2-ylphosphane?
The InChIKey is VCDVNPUVHNXKAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9P.C4H10/c11-10-6-5-8-3-1-2-4-9(8)7-10;1-3-4-2/h1-7H,11H2;3-4H2,1-2H3.
What are the key properties of butane;naphthalen-2-ylphosphane?
butane;naphthalen-2-ylphosphane has a molecular weight of 218.28 g/mol, XLogP of 4.15, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butane;naphthalen-2-ylphosphane is sourced from PubChem (CID 174828877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).