C17H27N3S — CID 145307768
N'-[2-(naphthalen-2-ylsulfanylamino)ethyl]ethane-1,2-diamine;propane (PubChem CID 145307768) has the molecular formula C17H27N3S and a molecular weight of 305.49 g/mol. Its IUPAC name is N'-[2-(naphthalen-2-ylsulfanylamino)ethyl]ethane-1,2-diamine;propane.
| Compound Name | N'-[2-(naphthalen-2-ylsulfanylamino)ethyl]ethane-1,2-diamine;propane |
|---|---|
| PubChem CID | 145307768 |
| Molecular Formula | C17H27N3S |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | N'-[2-(naphthalen-2-ylsulfanylamino)ethyl]ethane-1,2-diamine;propane |
| SMILES | CCC.NCCNCCNSc1ccc2ccccc2c1 |
| InChI | InChI=1S/C14H19N3S.C3H8/c15-7-8-16-9-10-17-18-14-6-5-12-3-1-2-4-13(12)11-14;1-3-2/h1-6,11,16-17H,7-10,15H2;3H2,1-2H3 |
| InChIKey | CYXPEEKJTHUBNZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|