C18H27N3S — CID 145307793
4-methyl-2-N-[2-(naphthalen-2-ylsulfanylamino)ethyl]pentane-1,2-diamine (PubChem CID 145307793) has the molecular formula C18H27N3S and a molecular weight of 317.50 g/mol. Its IUPAC name is 4-methyl-2-N-[2-(naphthalen-2-ylsulfanylamino)ethyl]pentane-1,2-diamine.
| Compound Name | 4-methyl-2-N-[2-(naphthalen-2-ylsulfanylamino)ethyl]pentane-1,2-diamine |
|---|---|
| PubChem CID | 145307793 |
| Molecular Formula | C18H27N3S |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 4-methyl-2-N-[2-(naphthalen-2-ylsulfanylamino)ethyl]pentane-1,2-diamine |
| SMILES | CC(C)CC(CN)NCCNSc1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H27N3S/c1-14(2)11-17(13-19)20-9-10-21-22-18-8-7-15-5-3-4-6-16(15)12-18/h3-8,12,14,17,20-21H,9-11,13,19H2,1-2H3 |
| InChIKey | MKNAGOBNENQOCJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|