About ethanamine;naphthalene-2-carbaldehyde
ethanamine;naphthalene-2-carbaldehyde (PubChem CID 143882987) has the molecular formula C13H15NO
and a molecular weight of 201.27 g/mol. Its IUPAC name is ethanamine;naphthalene-2-carbaldehyde.
Molecular Properties
| Compound Name | ethanamine;naphthalene-2-carbaldehyde |
| PubChem CID | 143882987 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | ethanamine;naphthalene-2-carbaldehyde |
| SMILES | CCN.O=Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C11H8O.C2H7N/c12-8-9-5-6-10-3-1-2-4-11(10)7-9;1-2-3/h1-8H;2-3H2,1H3 |
| InChIKey | YLLWSWRDDDALOL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethanamine;naphthalene-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;naphthalene-2-carbaldehyde?
The IUPAC name of ethanamine;naphthalene-2-carbaldehyde (CID 143882987) is ethanamine;naphthalene-2-carbaldehyde.
What is the SMILES notation for ethanamine;naphthalene-2-carbaldehyde?
The canonical SMILES for ethanamine;naphthalene-2-carbaldehyde is CCN.O=Cc1ccc2ccccc2c1.
What is the InChIKey of ethanamine;naphthalene-2-carbaldehyde?
The InChIKey is YLLWSWRDDDALOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8O.C2H7N/c12-8-9-5-6-10-3-1-2-4-11(10)7-9;1-2-3/h1-8H;2-3H2,1H3.
What are the key properties of ethanamine;naphthalene-2-carbaldehyde?
ethanamine;naphthalene-2-carbaldehyde has a molecular weight of 201.27 g/mol, XLogP of 2.62, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;naphthalene-2-carbaldehyde is sourced from PubChem (CID 143882987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).